C21H27NO4S — CID 69121621
2-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]pentanoic acid (PubChem CID 69121621) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]pentanoic acid.
| Compound Name | 2-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]pentanoic acid |
|---|---|
| PubChem CID | 69121621 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]pentanoic acid |
| SMILES | CCCC(Oc1c(C(=O)NCC2CCCCC2)sc2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H27NO4S/c1-2-8-16(21(24)25)26-18-15-11-6-7-12-17(15)27-19(18)20(23)22-13-14-9-4-3-5-10-14/h6-7,11-12,14,16H,2-5,8-10,13H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | DFCQQOPCOSKGPL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |