C19H27N3O5S — CID 56572573
N-(2-cyanoethyl)-N-(oxan-4-yl)-2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetamide (PubChem CID 56572573) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(oxan-4-yl)-2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-N-(oxan-4-yl)-2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetamide |
|---|---|
| PubChem CID | 56572573 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-(2-cyanoethyl)-N-(oxan-4-yl)-2-[(4-propan-2-yloxyphenyl)sulfamoyl]acetamide |
| SMILES | CC(C)Oc1ccc(NS(=O)(=O)CC(=O)N(CCC#N)C2CCOCC2)cc1 |
| InChI | InChI=1S/C19H27N3O5S/c1-15(2)27-18-6-4-16(5-7-18)21-28(24,25)14-19(23)22(11-3-10-20)17-8-12-26-13-9-17/h4-7,15,17,21H,3,8-9,11-14H2,1-2H3 |
| InChIKey | RSZWDJLASKHTTN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |