C24H27N5O2 — CID 56572809
N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 56572809) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 56572809 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)c2cc(C)nc3c2nc2n3CCCCC2)cc1 |
| InChI | InChI=1S/C24H27N5O2/c1-3-31-19-11-9-18(10-12-19)28(15-7-13-25)24(30)20-16-17(2)26-23-22(20)27-21-8-5-4-6-14-29(21)23/h9-12,16H,3-8,14-15H2,1-2H3 |
| InChIKey | RLJNLCGGUMQUFX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |