C25H32N4O3 — CID 46604113
N-[2-(3,4-diethoxyphenyl)ethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 46604113) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 46604113 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2cc(C)nc3c2nc2n3CCCCC2)cc1OCC |
| InChI | InChI=1S/C25H32N4O3/c1-4-31-20-11-10-18(16-21(20)32-5-2)12-13-26-25(30)19-15-17(3)27-24-23(19)28-22-9-7-6-8-14-29(22)24/h10-11,15-16H,4-9,12-14H2,1-3H3,(H,26,30) |
| InChIKey | SYKDQFPYFJEXPD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |