C19H27N5O2 — CID 48503776
N-[2-(diethylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 48503776) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 48503776 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N-[2-(diethylamino)-2-oxoethyl]-4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | CCN(CC)C(=O)CNC(=O)c1cc(C)nc2c1nc1n2CCCCC1 |
| InChI | InChI=1S/C19H27N5O2/c1-4-23(5-2)16(25)12-20-19(26)14-11-13(3)21-18-17(14)22-15-9-7-6-8-10-24(15)18/h11H,4-10,12H2,1-3H3,(H,20,26) |
| InChIKey | ATGFENXDTNTODQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |