C22H25N5O2S — CID 56580061
S-[4-[(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56580061) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is S-[4-[(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56580061 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | S-[4-[(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1cc(C(=O)Nc2ccc(SC(=O)N(C)C)cc2)c2nc3n(c2n1)CCCCC3 |
| InChI | InChI=1S/C22H25N5O2S/c1-14-13-17(19-20(23-14)27-12-6-4-5-7-18(27)25-19)21(28)24-15-8-10-16(11-9-15)30-22(29)26(2)3/h8-11,13H,4-7,12H2,1-3H3,(H,24,28) |
| InChIKey | JPVYZMXSCFUBBN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|