C23H26N4O — CID 46547590
4-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 46547590) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | 4-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 46547590 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCCc3ccccc32)c2nc3n(c2n1)CCCCC3 |
| InChI | InChI=1S/C23H26N4O/c1-15-14-18(21-22(24-15)27-13-6-2-3-12-20(27)26-21)23(28)25-19-11-7-9-16-8-4-5-10-17(16)19/h4-5,8,10,14,19H,2-3,6-7,9,11-13H2,1H3,(H,25,28) |
| InChIKey | WXGLZMMGHQXJIR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |