C22H23F3N4O — CID 46538948
4-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 46538948) has the molecular formula C22H23F3N4O and a molecular weight of 416.45 g/mol. Its IUPAC name is 4-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | 4-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 46538948 |
| Molecular Formula | C22H23F3N4O |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-methyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | Cc1cc(C(=O)NCCc2ccc(C(F)(F)F)cc2)c2nc3n(c2n1)CCCCC3 |
| InChI | InChI=1S/C22H23F3N4O/c1-14-13-17(19-20(27-14)29-12-4-2-3-5-18(29)28-19)21(30)26-11-10-15-6-8-16(9-7-15)22(23,24)25/h6-9,13H,2-5,10-12H2,1H3,(H,26,30) |
| InChIKey | QEWHQXBXUIXOPG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |