C23H25F3N4O2 — CID 46549855
4-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide (PubChem CID 46549855) has the molecular formula C23H25F3N4O2 and a molecular weight of 446.47 g/mol. Its IUPAC name is 4-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide.
| Compound Name | 4-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 46549855 |
| Molecular Formula | C23H25F3N4O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraene-6-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(COCC(F)(F)F)cc2)c2nc3n(c2n1)CCCCC3 |
| InChI | InChI=1S/C23H25F3N4O2/c1-15-11-18(20-21(28-15)30-10-4-2-3-5-19(30)29-20)22(31)27-12-16-6-8-17(9-7-16)13-32-14-23(24,25)26/h6-9,11H,2-5,10,12-14H2,1H3,(H,27,31) |
| InChIKey | FJOREMANEVJSJO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |