C21H29N5O3S — CID 56573401
3-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]butane-1-sulfonamide (PubChem CID 56573401) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 3-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]butane-1-sulfonamide.
| Compound Name | 3-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 56573401 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]butane-1-sulfonamide |
| SMILES | CC(C)CCS(=O)(=O)Nc1ccc(CC(=O)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C21H29N5O3S/c1-17(2)8-15-30(28,29)24-19-6-4-18(5-7-19)16-20(27)25-11-13-26(14-12-25)21-22-9-3-10-23-21/h3-7,9-10,17,24H,8,11-16H2,1-2H3 |
| InChIKey | RRODAFDPUZXEEJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |