C24H31FN4O — CID 56573762
2-(3-fluoroanilino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]pyridine-3-carboxamide (PubChem CID 56573762) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-(3-fluoroanilino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-(3-fluoroanilino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56573762 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-(3-fluoroanilino)-N-[(1-piperidin-1-ylcyclohexyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1(N2CCCCC2)CCCCC1)c1cccnc1Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H31FN4O/c25-19-9-7-10-20(17-19)28-22-21(11-8-14-26-22)23(30)27-18-24(12-3-1-4-13-24)29-15-5-2-6-16-29/h7-11,14,17H,1-6,12-13,15-16,18H2,(H,26,28)(H,27,30) |
| InChIKey | KYGCYFGVJAJFJO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |