C19H25ClFN3O — CID 56574719
2-[(2-chloro-6-fluorophenyl)methyl-(2,3-dimethylcyclohexyl)amino]-N-(cyanomethyl)acetamide (PubChem CID 56574719) has the molecular formula C19H25ClFN3O and a molecular weight of 365.88 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl-(2,3-dimethylcyclohexyl)amino]-N-(cyanomethyl)acetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl-(2,3-dimethylcyclohexyl)amino]-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 56574719 |
| Molecular Formula | C19H25ClFN3O |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl-(2,3-dimethylcyclohexyl)amino]-N-(cyanomethyl)acetamide |
| SMILES | CC1CCCC(N(CC(=O)NCC#N)Cc2c(F)cccc2Cl)C1C |
| InChI | InChI=1S/C19H25ClFN3O/c1-13-5-3-8-18(14(13)2)24(12-19(25)23-10-9-22)11-15-16(20)6-4-7-17(15)21/h4,6-7,13-14,18H,3,5,8,10-12H2,1-2H3,(H,23,25) |
| InChIKey | NPOLHFAJJJPHNU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|