C20H23N3O3S2 — CID 56576789
S-[4-[2-(4-acetamidophenyl)sulfanylpropanoylamino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56576789) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is S-[4-[2-(4-acetamidophenyl)sulfanylpropanoylamino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[2-(4-acetamidophenyl)sulfanylpropanoylamino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56576789 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | S-[4-[2-(4-acetamidophenyl)sulfanylpropanoylamino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CC(=O)Nc1ccc(SC(C)C(=O)Nc2ccc(SC(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-13(27-17-9-5-15(6-10-17)21-14(2)24)19(25)22-16-7-11-18(12-8-16)28-20(26)23(3)4/h5-13H,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | RDDJPLUVYWQTTR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|