C22H37N3O2 — CID 56580231
3-[[benzyl(methyl)carbamoyl]amino]-N-pentan-2-yl-N-pentylpropanamide (PubChem CID 56580231) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-pentan-2-yl-N-pentylpropanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-pentan-2-yl-N-pentylpropanamide |
|---|---|
| PubChem CID | 56580231 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-pentan-2-yl-N-pentylpropanamide |
| SMILES | CCCCCN(C(=O)CCNC(=O)N(C)Cc1ccccc1)C(C)CCC |
| InChI | InChI=1S/C22H37N3O2/c1-5-7-11-17-25(19(3)12-6-2)21(26)15-16-23-22(27)24(4)18-20-13-9-8-10-14-20/h8-10,13-14,19H,5-7,11-12,15-18H2,1-4H3,(H,23,27) |
| InChIKey | ZPVXYBJVCWITFM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|