C20H31N3O5S — CID 56580528
ethyl 3-[(1-ethylpyrrolidin-2-yl)methyl-[2-(4-sulfamoylphenyl)acetyl]amino]propanoate (PubChem CID 56580528) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is ethyl 3-[(1-ethylpyrrolidin-2-yl)methyl-[2-(4-sulfamoylphenyl)acetyl]amino]propanoate.
| Compound Name | ethyl 3-[(1-ethylpyrrolidin-2-yl)methyl-[2-(4-sulfamoylphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 56580528 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ethyl 3-[(1-ethylpyrrolidin-2-yl)methyl-[2-(4-sulfamoylphenyl)acetyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(CC1CCCN1CC)C(=O)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H31N3O5S/c1-3-22-12-5-6-17(22)15-23(13-11-20(25)28-4-2)19(24)14-16-7-9-18(10-8-16)29(21,26)27/h7-10,17H,3-6,11-15H2,1-2H3,(H2,21,26,27) |
| InChIKey | ZYNJDWWTPMZUEZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |