C21H28N4O5S — CID 56581640
8-[4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 56581640) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is 8-[4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 56581640 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 8-[4-(2,4-dimethylphenyl)sulfonylpiperazine-1-carbonyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)C3CCC4(CC3)NC(=O)NC4=O)CC2)c(C)c1 |
| InChI | InChI=1S/C21H28N4O5S/c1-14-3-4-17(15(2)13-14)31(29,30)25-11-9-24(10-12-25)18(26)16-5-7-21(8-6-16)19(27)22-20(28)23-21/h3-4,13,16H,5-12H2,1-2H3,(H2,22,23,27,28) |
| InChIKey | SRHZGSHYRZUVPG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|