C25H25N3O4 — CID 56582400
2-(2-ethoxyethoxy)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide (PubChem CID 56582400) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 2-(2-ethoxyethoxy)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 56582400 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)Nc1cccc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C25H25N3O4/c1-2-30-14-15-31-23-11-4-3-10-22(23)25(29)27-19-8-7-9-21(16-19)32-18-20-17-28-13-6-5-12-24(28)26-20/h3-13,16-17H,2,14-15,18H2,1H3,(H,27,29) |
| InChIKey | YEFYHNLQXCMLKA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|