C19H18FN5S — CID 56584424
2-fluoro-6-[4-[(3-thiophen-3-ylpyrazol-1-yl)methyl]piperazin-1-yl]benzonitrile (PubChem CID 56584424) has the molecular formula C19H18FN5S and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-fluoro-6-[4-[(3-thiophen-3-ylpyrazol-1-yl)methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-fluoro-6-[4-[(3-thiophen-3-ylpyrazol-1-yl)methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 56584424 |
| Molecular Formula | C19H18FN5S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-fluoro-6-[4-[(3-thiophen-3-ylpyrazol-1-yl)methyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1c(F)cccc1N1CCN(Cn2ccc(-c3ccsc3)n2)CC1 |
| InChI | InChI=1S/C19H18FN5S/c20-17-2-1-3-19(16(17)12-21)24-9-7-23(8-10-24)14-25-6-4-18(22-25)15-5-11-26-13-15/h1-6,11,13H,7-10,14H2 |
| InChIKey | IUZFLPNRYSSJSN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |