C22H20ClN3O3S — CID 56584658
N-[4-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]oxy]phenyl]thiophene-2-carboxamide (PubChem CID 56584658) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is N-[4-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]oxy]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]oxy]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 56584658 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-[4-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]oxy]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ncc(C(=O)N3CCCCC3)cc2Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C22H20ClN3O3S/c23-18-13-15(22(28)26-10-2-1-3-11-26)14-24-21(18)29-17-8-6-16(7-9-17)25-20(27)19-5-4-12-30-19/h4-9,12-14H,1-3,10-11H2,(H,25,27) |
| InChIKey | GTNVKUYPWLLFJW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |