C24H30N6O2 — CID 56584916
2-N,4-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]quinazoline-2,4-diamine (PubChem CID 56584916) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-N,4-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]quinazoline-2,4-diamine.
| Compound Name | 2-N,4-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 56584916 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-N,4-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]quinazoline-2,4-diamine |
| SMILES | CN(C)C(CNc1nc(NCC(c2ccco2)N(C)C)c2ccccc2n1)c1ccco1 |
| InChI | InChI=1S/C24H30N6O2/c1-29(2)19(21-11-7-13-31-21)15-25-23-17-9-5-6-10-18(17)27-24(28-23)26-16-20(30(3)4)22-12-8-14-32-22/h5-14,19-20H,15-16H2,1-4H3,(H2,25,26,27,28) |
| InChIKey | HIFKNFGKDCOAAR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |