C22H21N3O4 — CID 56588503
N-[[1-[2-(1-benzofuran-2-yl)-2-oxoacetyl]piperidin-4-yl]methyl]pyridine-3-carboxamide (PubChem CID 56588503) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[[1-[2-(1-benzofuran-2-yl)-2-oxoacetyl]piperidin-4-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[1-[2-(1-benzofuran-2-yl)-2-oxoacetyl]piperidin-4-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56588503 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[[1-[2-(1-benzofuran-2-yl)-2-oxoacetyl]piperidin-4-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCN(C(=O)C(=O)c2cc3ccccc3o2)CC1)c1cccnc1 |
| InChI | InChI=1S/C22H21N3O4/c26-20(19-12-16-4-1-2-6-18(16)29-19)22(28)25-10-7-15(8-11-25)13-24-21(27)17-5-3-9-23-14-17/h1-6,9,12,14-15H,7-8,10-11,13H2,(H,24,27) |
| InChIKey | QLZVEVZTOXFOHM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|