C20H17FN2O2S — CID 56588669
1-(4-fluorophenyl)sulfonyl-6-phenyl-3,4-dihydro-2H-1,5-naphthyridine (PubChem CID 56588669) has the molecular formula C20H17FN2O2S and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-6-phenyl-3,4-dihydro-2H-1,5-naphthyridine.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-6-phenyl-3,4-dihydro-2H-1,5-naphthyridine |
|---|---|
| PubChem CID | 56588669 |
| Molecular Formula | C20H17FN2O2S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-6-phenyl-3,4-dihydro-2H-1,5-naphthyridine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCCc2nc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C20H17FN2O2S/c21-16-8-10-17(11-9-16)26(24,25)23-14-4-7-19-20(23)13-12-18(22-19)15-5-2-1-3-6-15/h1-3,5-6,8-13H,4,7,14H2 |
| InChIKey | NKLKIMQBBUIJAZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |