C25H20N4OS — CID 56590756
11-(4-methoxyphenyl)-3,5-diphenyl-10-thia-1,4,5,7-tetrazatricyclo[6.3.0.02,6]undeca-2(6),3,7-triene (PubChem CID 56590756) has the molecular formula C25H20N4OS and a molecular weight of 424.53 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-3,5-diphenyl-10-thia-1,4,5,7-tetrazatricyclo[6.3.0.02,6]undeca-2(6),3,7-triene.
| Compound Name | 11-(4-methoxyphenyl)-3,5-diphenyl-10-thia-1,4,5,7-tetrazatricyclo[6.3.0.02,6]undeca-2(6),3,7-triene |
|---|---|
| PubChem CID | 56590756 |
| Molecular Formula | C25H20N4OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 11-(4-methoxyphenyl)-3,5-diphenyl-10-thia-1,4,5,7-tetrazatricyclo[6.3.0.02,6]undeca-2(6),3,7-triene |
| SMILES | COc1ccc(C2SCc3nc4c(c(-c5ccccc5)nn4-c4ccccc4)n32)cc1 |
| InChI | InChI=1S/C25H20N4OS/c1-30-20-14-12-18(13-15-20)25-28-21(16-31-25)26-24-23(28)22(17-8-4-2-5-9-17)27-29(24)19-10-6-3-7-11-19/h2-15,25H,16H2,1H3 |
| InChIKey | LMQTVXIOUOKWBJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |