C23H18F3N3O4S — CID 56593295
2-(2-ethoxyphenyl)-N-[3-(trifluoromethylsulfonyl)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 56593295) has the molecular formula C23H18F3N3O4S and a molecular weight of 489.48 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-N-[3-(trifluoromethylsulfonyl)phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-(2-ethoxyphenyl)-N-[3-(trifluoromethylsulfonyl)phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 56593295 |
| Molecular Formula | C23H18F3N3O4S |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2-(2-ethoxyphenyl)-N-[3-(trifluoromethylsulfonyl)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CCOc1ccccc1-c1nc2c(C(=O)Nc3cccc(S(=O)(=O)C(F)(F)F)c3)cccc2[nH]1 |
| InChI | InChI=1S/C23H18F3N3O4S/c1-2-33-19-12-4-3-9-16(19)21-28-18-11-6-10-17(20(18)29-21)22(30)27-14-7-5-8-15(13-14)34(31,32)23(24,25)26/h3-13H,2H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | NZNCPPMZUDTQKE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |