About (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride
(1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride (PubChem CID 56595195) has the molecular formula C5H9ClF3N
and a molecular weight of 175.58 g/mol. Its IUPAC name is (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride |
| PubChem CID | 56595195 |
| Molecular Formula | C5H9ClF3N |
| Molecular Weight | 175.58 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@H](C1CC1)C(F)(F)F |
| InChI | InChI=1S/C5H8F3N.ClH/c6-5(7,8)4(9)3-1-2-3;/h3-4H,1-2,9H2;1H/t4-;/m1./s1 |
| InChIKey | SYGCZMSQFRLXRX-PGMHMLKASA-N |
| XLogP | 1.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride?
The IUPAC name of (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride (CID 56595195) is (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride.
What is the SMILES notation for (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride?
The canonical SMILES for (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride is Cl.N[C@H](C1CC1)C(F)(F)F.
What is the InChIKey of (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride?
The InChIKey is SYGCZMSQFRLXRX-PGMHMLKASA-N. The full InChI is InChI=1S/C5H8F3N.ClH/c6-5(7,8)4(9)3-1-2-3;/h3-4H,1-2,9H2;1H/t4-;/m1./s1.
What are the key properties of (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride?
(1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride has a molecular weight of 175.58 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyclopropyl-2,2,2-trifluoroethanamine;hydrochloride is sourced from PubChem (CID 56595195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).