C14H22O4 — CID 56595626
(1R,2R,5R)-1-(1,3-dioxolan-2-ylmethyl)-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylic acid (PubChem CID 56595626) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1R,2R,5R)-1-(1,3-dioxolan-2-ylmethyl)-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,5R)-1-(1,3-dioxolan-2-ylmethyl)-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 56595626 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1R,2R,5R)-1-(1,3-dioxolan-2-ylmethyl)-2-methyl-5-prop-1-en-2-ylcyclopentane-1-carboxylic acid |
| SMILES | C=C(C)[C@H]1CC[C@@H](C)[C@@]1(CC1OCCO1)C(=O)O |
| InChI | InChI=1S/C14H22O4/c1-9(2)11-5-4-10(3)14(11,13(15)16)8-12-17-6-7-18-12/h10-12H,1,4-8H2,2-3H3,(H,15,16)/t10-,11-,14-/m1/s1 |
| InChIKey | DMSBDGJIRGFYIM-JTNHKYCSSA-N |
| XLogP | 2.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|