C22H40O3 — CID 130382765
5-hydroxy-4-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)oxolan-2-one (PubChem CID 130382765) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is 5-hydroxy-4-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)oxolan-2-one.
| Compound Name | 5-hydroxy-4-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)oxolan-2-one |
|---|---|
| PubChem CID | 130382765 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 5-hydroxy-4-(4,4,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)oxolan-2-one |
| SMILES | C=C(CC1CC(=O)OC1O)CC(C)(C)C(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O3/c1-15(11-16-12-17(23)25-18(16)24)13-20(5,6)22(9,10)14-21(7,8)19(2,3)4/h16,18,24H,1,11-14H2,2-10H3 |
| InChIKey | CLPCNDUTVQVWQU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|