C16H28O3 — CID 123699777
5-hydroxy-4-(3,3,5,6,6-pentamethylhept-1-en-2-yl)oxolan-2-one (PubChem CID 123699777) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 5-hydroxy-4-(3,3,5,6,6-pentamethylhept-1-en-2-yl)oxolan-2-one.
| Compound Name | 5-hydroxy-4-(3,3,5,6,6-pentamethylhept-1-en-2-yl)oxolan-2-one |
|---|---|
| PubChem CID | 123699777 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 5-hydroxy-4-(3,3,5,6,6-pentamethylhept-1-en-2-yl)oxolan-2-one |
| SMILES | C=C(C1CC(=O)OC1O)C(C)(C)CC(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O3/c1-10(15(3,4)5)9-16(6,7)11(2)12-8-13(17)19-14(12)18/h10,12,14,18H,2,8-9H2,1,3-7H3 |
| InChIKey | NOQNDLHMJMGKTP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|