C27H25F4N5O4 — CID 56595724
3-[(2,6-difluoro-4-methoxyphenyl)methyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-6-[(4,6-dimethyl-3-pyridinyl)methylamino]-1,3,5-triazine-2,4-dione (PubChem CID 56595724) has the molecular formula C27H25F4N5O4 and a molecular weight of 559.52 g/mol. Its IUPAC name is 3-[(2,6-difluoro-4-methoxyphenyl)methyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-6-[(4,6-dimethyl-3-pyridinyl)methylamino]-1,3,5-triazine-2,4-dione.
| Compound Name | 3-[(2,6-difluoro-4-methoxyphenyl)methyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-6-[(4,6-dimethyl-3-pyridinyl)methylamino]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 56595724 |
| Molecular Formula | C27H25F4N5O4 |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 3-[(2,6-difluoro-4-methoxyphenyl)methyl]-1-[[4-(difluoromethoxy)phenyl]methyl]-6-[(4,6-dimethyl-3-pyridinyl)methylamino]-1,3,5-triazine-2,4-dione |
| SMILES | COc1cc(F)c(Cn2c(=O)nc(NCc3cnc(C)cc3C)n(Cc3ccc(OC(F)F)cc3)c2=O)c(F)c1 |
| InChI | InChI=1S/C27H25F4N5O4/c1-15-8-16(2)32-11-18(15)12-33-25-34-26(37)36(14-21-22(28)9-20(39-3)10-23(21)29)27(38)35(25)13-17-4-6-19(7-5-17)40-24(30)31/h4-11,24H,12-14H2,1-3H3,(H,33,34,37) |
| InChIKey | RVCHRRVTYUYJKG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |