C25H25N7O6 — CID 56596404
6-[(2-amino-3-pyridinyl)methylamino]-3-[(4-methoxy-3-nitrophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 56596404) has the molecular formula C25H25N7O6 and a molecular weight of 519.52 g/mol. Its IUPAC name is 6-[(2-amino-3-pyridinyl)methylamino]-3-[(4-methoxy-3-nitrophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(2-amino-3-pyridinyl)methylamino]-3-[(4-methoxy-3-nitrophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 56596404 |
| Molecular Formula | C25H25N7O6 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 6-[(2-amino-3-pyridinyl)methylamino]-3-[(4-methoxy-3-nitrophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | COc1ccc(Cn2c(NCc3cccnc3N)nc(=O)n(Cc3ccc(OC)c([N+](=O)[O-])c3)c2=O)cc1 |
| InChI | InChI=1S/C25H25N7O6/c1-37-19-8-5-16(6-9-19)14-30-23(28-13-18-4-3-11-27-22(18)26)29-24(33)31(25(30)34)15-17-7-10-21(38-2)20(12-17)32(35)36/h3-12H,13-15H2,1-2H3,(H2,26,27)(H,28,29,33) |
| InChIKey | GTEIDAQIYTXRDG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|