C14H16N2NaO7P2+ — CID 56596718
sodium [3-(1-methyl-6-oxo-4-phenylpyrimidin-2-yl)-1-phosphonoprop-1-enyl]phosphonic acid (PubChem CID 56596718) has the molecular formula C14H16N2NaO7P2+ and a molecular weight of 409.23 g/mol. Its IUPAC name is sodium [3-(1-methyl-6-oxo-4-phenylpyrimidin-2-yl)-1-phosphonoprop-1-enyl]phosphonic acid.
| Compound Name | sodium [3-(1-methyl-6-oxo-4-phenylpyrimidin-2-yl)-1-phosphonoprop-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 56596718 |
| Molecular Formula | C14H16N2NaO7P2+ |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | sodium [3-(1-methyl-6-oxo-4-phenylpyrimidin-2-yl)-1-phosphonoprop-1-enyl]phosphonic acid |
| SMILES | Cn1c(CC=C(P(=O)(O)O)P(=O)(O)O)nc(-c2ccccc2)cc1=O.[Na+] |
| InChI | InChI=1S/C14H16N2O7P2.Na/c1-16-12(7-8-14(24(18,19)20)25(21,22)23)15-11(9-13(16)17)10-5-3-2-4-6-10;/h2-6,8-9H,7H2,1H3,(H2,18,19,20)(H2,21,22,23);/q;+1 |
| InChIKey | XPMZPEZEZRASOW-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|