C25H28N2O3 — CID 18717793
2-ethyl-3-[2-[4-(2-methyl-3-oxobutyl)phenoxy]ethyl]-6-phenylpyrimidin-4-one (PubChem CID 18717793) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-ethyl-3-[2-[4-(2-methyl-3-oxobutyl)phenoxy]ethyl]-6-phenylpyrimidin-4-one.
| Compound Name | 2-ethyl-3-[2-[4-(2-methyl-3-oxobutyl)phenoxy]ethyl]-6-phenylpyrimidin-4-one |
|---|---|
| PubChem CID | 18717793 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-ethyl-3-[2-[4-(2-methyl-3-oxobutyl)phenoxy]ethyl]-6-phenylpyrimidin-4-one |
| SMILES | CCc1nc(-c2ccccc2)cc(=O)n1CCOc1ccc(CC(C)C(C)=O)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-4-24-26-23(21-8-6-5-7-9-21)17-25(29)27(24)14-15-30-22-12-10-20(11-13-22)16-18(2)19(3)28/h5-13,17-18H,4,14-16H2,1-3H3 |
| InChIKey | XLIOBYVNHKOMOB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |