C27H33N3O4 — CID 10161873
ethyl (2S)-2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]anilino]pentanoate (PubChem CID 10161873) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is ethyl (2S)-2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]anilino]pentanoate.
| Compound Name | ethyl (2S)-2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]anilino]pentanoate |
|---|---|
| PubChem CID | 10161873 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | ethyl (2S)-2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]anilino]pentanoate |
| SMILES | CCC[C@H](Nc1ccc(OCCn2c(CC)nc(-c3ccccc3)cc2=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C27H33N3O4/c1-4-10-23(27(32)33-6-3)28-21-13-15-22(16-14-21)34-18-17-30-25(5-2)29-24(19-26(30)31)20-11-8-7-9-12-20/h7-9,11-16,19,23,28H,4-6,10,17-18H2,1-3H3/t23-/m0/s1 |
| InChIKey | XAEQXDOUIKCNKL-QHCPKHFHSA-N |
| XLogP | 4.70 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|