C26H30N2O5 — CID 10114840
ethyl 2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]phenoxy]-2-methylpropanoate (PubChem CID 10114840) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is ethyl 2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 10114840 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | ethyl 2-[4-[2-(2-ethyl-6-oxo-4-phenylpyrimidin-1-yl)ethoxy]phenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(OCCn2c(CC)nc(-c3ccccc3)cc2=O)cc1 |
| InChI | InChI=1S/C26H30N2O5/c1-5-23-27-22(19-10-8-7-9-11-19)18-24(29)28(23)16-17-32-20-12-14-21(15-13-20)33-26(3,4)25(30)31-6-2/h7-15,18H,5-6,16-17H2,1-4H3 |
| InChIKey | NSVXHXDZFAQLEF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |