C21H20F2N4O4S — CID 56597493
N-(6-fluoro-1,3-benzothiazol-2-yl)-4-[3-fluoro-5-[(1S,2S)-1,2,3-trihydroxypropyl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 56597493) has the molecular formula C21H20F2N4O4S and a molecular weight of 462.48 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-4-[3-fluoro-5-[(1S,2S)-1,2,3-trihydroxypropyl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-4-[3-fluoro-5-[(1S,2S)-1,2,3-trihydroxypropyl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 56597493 |
| Molecular Formula | C21H20F2N4O4S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-4-[3-fluoro-5-[(1S,2S)-1,2,3-trihydroxypropyl]-2-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)N1CC=C(c2ncc([C@H](O)[C@@H](O)CO)cc2F)CC1 |
| InChI | InChI=1S/C21H20F2N4O4S/c22-13-1-2-15-17(8-13)32-20(25-15)26-21(31)27-5-3-11(4-6-27)18-14(23)7-12(9-24-18)19(30)16(29)10-28/h1-3,7-9,16,19,28-30H,4-6,10H2,(H,25,26,31)/t16-,19-/m0/s1 |
| InChIKey | KMKFKAZDHHWIJX-LPHOPBHVSA-N |
| XLogP | 2.68 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |