C29H33N3O4 — CID 56597574
N-[(2S)-3-naphthalen-1-yl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]propan-2-yl]benzamide (PubChem CID 56597574) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[(2S)-3-naphthalen-1-yl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]propan-2-yl]benzamide.
| Compound Name | N-[(2S)-3-naphthalen-1-yl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 56597574 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[(2S)-3-naphthalen-1-yl-1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]propan-2-yl]benzamide |
| SMILES | CCCC[C@@H](C=O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H33N3O4/c1-3-4-16-24(19-33)31-27(34)20(2)30-29(36)26(32-28(35)22-12-6-5-7-13-22)18-23-15-10-14-21-11-8-9-17-25(21)23/h5-15,17,19-20,24,26H,3-4,16,18H2,1-2H3,(H,30,36)(H,31,34)(H,32,35)/t20-,24-,26-/m0/s1 |
| InChIKey | SWOKPNROKIJXNS-RJWMVNQGSA-N |
| XLogP | 3.56 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|