C26H33N3O5 — CID 56646444
4-methoxy-N-[1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]-3-phenylpropan-2-yl]benzamide (PubChem CID 56646444) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-methoxy-N-[1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]-3-phenylpropan-2-yl]benzamide.
| Compound Name | 4-methoxy-N-[1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 56646444 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-methoxy-N-[1-oxo-1-[[(2S)-1-oxo-1-[[(2S)-1-oxohexan-2-yl]amino]propan-2-yl]amino]-3-phenylpropan-2-yl]benzamide |
| SMILES | CCCC[C@@H](C=O)NC(=O)[C@H](C)NC(=O)C(Cc1ccccc1)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H33N3O5/c1-4-5-11-21(17-30)28-24(31)18(2)27-26(33)23(16-19-9-7-6-8-10-19)29-25(32)20-12-14-22(34-3)15-13-20/h6-10,12-15,17-18,21,23H,4-5,11,16H2,1-3H3,(H,27,33)(H,28,31)(H,29,32)/t18-,21-,23?/m0/s1 |
| InChIKey | RFSPVMGRDZYRQU-FJOSRBEHSA-N |
| XLogP | 2.41 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|