C21H24NO2P — CID 56600248
ethyl 2-methyl-4,4-diphenyl-1-aza-4λ5-phosphacyclohepta-1,3-diene-3-carboxylate (PubChem CID 56600248) has the molecular formula C21H24NO2P and a molecular weight of 353.40 g/mol. Its IUPAC name is ethyl 2-methyl-4,4-diphenyl-1-aza-4λ5-phosphacyclohepta-1,3-diene-3-carboxylate.
| Compound Name | ethyl 2-methyl-4,4-diphenyl-1-aza-4λ5-phosphacyclohepta-1,3-diene-3-carboxylate |
|---|---|
| PubChem CID | 56600248 |
| Molecular Formula | C21H24NO2P |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | ethyl 2-methyl-4,4-diphenyl-1-aza-4λ5-phosphacyclohepta-1,3-diene-3-carboxylate |
| SMILES | CCOC(=O)C1=P(c2ccccc2)(c2ccccc2)CCCN=C1C |
| InChI | InChI=1S/C21H24NO2P/c1-3-24-21(23)20-17(2)22-15-10-16-25(20,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14H,3,10,15-16H2,1-2H3 |
| InChIKey | CNUBPNXSKIINNN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|