C18H26O6 — CID 56600286
[(2R)-hept-6-en-2-yl] (2E,4R,5S)-4,5-diacetyloxyhepta-2,6-dienoate (PubChem CID 56600286) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is [(2R)-hept-6-en-2-yl] (2E,4R,5S)-4,5-diacetyloxyhepta-2,6-dienoate.
| Compound Name | [(2R)-hept-6-en-2-yl] (2E,4R,5S)-4,5-diacetyloxyhepta-2,6-dienoate |
|---|---|
| PubChem CID | 56600286 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [(2R)-hept-6-en-2-yl] (2E,4R,5S)-4,5-diacetyloxyhepta-2,6-dienoate |
| SMILES | C=CCCC[C@@H](C)OC(=O)/C=C/[C@@H](OC(C)=O)[C@H](C=C)OC(C)=O |
| InChI | InChI=1S/C18H26O6/c1-6-8-9-10-13(3)22-18(21)12-11-17(24-15(5)20)16(7-2)23-14(4)19/h6-7,11-13,16-17H,1-2,8-10H2,3-5H3/b12-11+/t13-,16+,17-/m1/s1 |
| InChIKey | CSHQBWULJWKVJI-KXVPETKVSA-N |
| XLogP | 2.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|