C25H31NO4 — CID 56600573
2-[6-(5-phenylpentoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetic acid (PubChem CID 56600573) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[6-(5-phenylpentoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetic acid.
| Compound Name | 2-[6-(5-phenylpentoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetic acid |
|---|---|
| PubChem CID | 56600573 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 2-[6-(5-phenylpentoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetic acid |
| SMILES | O=C(O)CN1CCC2(CC1)COc1cc(OCCCCCc3ccccc3)ccc12 |
| InChI | InChI=1S/C25H31NO4/c27-24(28)18-26-14-12-25(13-15-26)19-30-23-17-21(10-11-22(23)25)29-16-6-2-5-9-20-7-3-1-4-8-20/h1,3-4,7-8,10-11,17H,2,5-6,9,12-16,18-19H2,(H,27,28) |
| InChIKey | BAQBQTHEGJHMPQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|