C23H27NO5 — CID 66655858
3-[6-(2-phenoxyethoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid (PubChem CID 66655858) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 3-[6-(2-phenoxyethoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid.
| Compound Name | 3-[6-(2-phenoxyethoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid |
|---|---|
| PubChem CID | 66655858 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3-[6-(2-phenoxyethoxy)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCC2(CC1)COc1cc(OCCOc3ccccc3)ccc12 |
| InChI | InChI=1S/C23H27NO5/c25-22(26)8-11-24-12-9-23(10-13-24)17-29-21-16-19(6-7-20(21)23)28-15-14-27-18-4-2-1-3-5-18/h1-7,16H,8-15,17H2,(H,25,26) |
| InChIKey | ZWUWKTNXKGVKOC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|