C17H23NO4 — CID 56601029
(4S)-4-benzyl-3-(2-pentan-3-yloxyacetyl)-1,3-oxazolidin-2-one (PubChem CID 56601029) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(2-pentan-3-yloxyacetyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(2-pentan-3-yloxyacetyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 56601029 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (4S)-4-benzyl-3-(2-pentan-3-yloxyacetyl)-1,3-oxazolidin-2-one |
| SMILES | CCC(CC)OCC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-3-15(4-2)21-12-16(19)18-14(11-22-17(18)20)10-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | PRBRSJFEUYGAMR-AWEZNQCLSA-N |
| XLogP | 2.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |