C28H33NO — CID 56602070
(1S,3aR,4S,6S)-9-benzyl-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole (PubChem CID 56602070) has the molecular formula C28H33NO and a molecular weight of 399.58 g/mol. Its IUPAC name is (1S,3aR,4S,6S)-9-benzyl-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole.
| Compound Name | (1S,3aR,4S,6S)-9-benzyl-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
|---|---|
| PubChem CID | 56602070 |
| Molecular Formula | C28H33NO |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (1S,3aR,4S,6S)-9-benzyl-1,4,7-trimethyl-6-(2-methylprop-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-phenaleno[2,1-d][1,3]oxazole |
| SMILES | CC(C)=C[C@@H]1C[C@H](C)[C@H]2CC[C@H](C)c3c2c1c(C)c1nc(Cc2ccccc2)oc31 |
| InChI | InChI=1S/C28H33NO/c1-16(2)13-21-14-18(4)22-12-11-17(3)24-26(22)25(21)19(5)27-28(24)30-23(29-27)15-20-9-7-6-8-10-20/h6-10,13,17-18,21-22H,11-12,14-15H2,1-5H3/t17-,18-,21+,22+/m0/s1 |
| InChIKey | ZVPPNJRHWYAKLA-MOXQZVSFSA-N |
| XLogP | 7.80 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|