C14H10IN4S2+ — CID 56602822
[2-(3-aminopyrazol-1-yl)-1,3-benzothiazol-6-yl]-thiophen-2-yliodanium (PubChem CID 56602822) has the molecular formula C14H10IN4S2+ and a molecular weight of 425.30 g/mol. Its IUPAC name is [2-(3-aminopyrazol-1-yl)-1,3-benzothiazol-6-yl]-thiophen-2-yliodanium.
| Compound Name | [2-(3-aminopyrazol-1-yl)-1,3-benzothiazol-6-yl]-thiophen-2-yliodanium |
|---|---|
| PubChem CID | 56602822 |
| Molecular Formula | C14H10IN4S2+ |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.94 |
| IUPAC Name | [2-(3-aminopyrazol-1-yl)-1,3-benzothiazol-6-yl]-thiophen-2-yliodanium |
| SMILES | Nc1ccn(-c2nc3ccc([I+]c4cccs4)cc3s2)n1 |
| InChI | InChI=1S/C14H10IN4S2/c16-13-5-6-19(18-13)14-17-10-4-3-9(8-11(10)21-14)15-12-2-1-7-20-12/h1-8H,(H2,16,18)/q+1 |
| InChIKey | XAJSAKGKDVTYGV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|