C15H24O4 — CID 56603819
(E)-5-[(1S)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-3-methylpent-4-enoic acid (PubChem CID 56603819) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (E)-5-[(1S)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-3-methylpent-4-enoic acid.
| Compound Name | (E)-5-[(1S)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-3-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 56603819 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (E)-5-[(1S)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-3-methylpent-4-enoic acid |
| SMILES | CC(/C=C/[C@@]1(O)C(C)CC(=O)CC1(C)C)CC(=O)O |
| InChI | InChI=1S/C15H24O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-6,10-11,19H,7-9H2,1-4H3,(H,17,18)/b6-5+/t10?,11?,15-/m1/s1 |
| InChIKey | IKYNGUXEEMEAFY-KSASRQGMSA-N |
| XLogP | 2.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|