C30H40O4 — CID 162874705
(2E,4E,6E,8E,10E,12E,14E,16E)-17-[(1R,6R)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenoic acid (PubChem CID 162874705) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E,16E)-17-[(1R,6R)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenoic acid.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E,16E)-17-[(1R,6R)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenoic acid |
|---|---|
| PubChem CID | 162874705 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E,16E)-17-[(1R,6R)-1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl]-2,6,11,15-tetramethylheptadeca-2,4,6,8,10,12,14,16-octaenoic acid |
| SMILES | CC(/C=C/C=C(C)/C=C/[C@]1(O)[C@H](C)CC(=O)CC1(C)C)=C\C=C\C=C(C)\C=C\C=C(/C)C(=O)O |
| InChI | InChI=1S/C30H40O4/c1-22(12-8-9-13-23(2)16-11-17-25(4)28(32)33)14-10-15-24(3)18-19-30(34)26(5)20-27(31)21-29(30,6)7/h8-19,26,34H,20-21H2,1-7H3,(H,32,33)/b9-8+,14-10+,16-11+,19-18+,22-12+,23-13+,24-15+,25-17+/t26-,30+/m1/s1 |
| InChIKey | FDJMTBRSNJXYKT-CMCRIDJTSA-N |
| XLogP | 6.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|