C22H30N2O3S — CID 56603891
N-[4-(diethylamino)-2-methylphenyl]-3-(2,6-dimethylphenyl)sulfonylpropanamide (PubChem CID 56603891) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-3-(2,6-dimethylphenyl)sulfonylpropanamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-3-(2,6-dimethylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 56603891 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-3-(2,6-dimethylphenyl)sulfonylpropanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCS(=O)(=O)c2c(C)cccc2C)c(C)c1 |
| InChI | InChI=1S/C22H30N2O3S/c1-6-24(7-2)19-11-12-20(18(5)15-19)23-21(25)13-14-28(26,27)22-16(3)9-8-10-17(22)4/h8-12,15H,6-7,13-14H2,1-5H3,(H,23,25) |
| InChIKey | SHTQDGNCSRZSRE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|