C23H29F3N2O6S — CID 56603869
N-[4-(diethylamino)-2-methylphenyl]-3-(2-methoxyphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 56603869) has the molecular formula C23H29F3N2O6S and a molecular weight of 518.55 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-3-(2-methoxyphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-3-(2-methoxyphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 56603869 |
| Molecular Formula | C23H29F3N2O6S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-3-(2-methoxyphenyl)sulfonylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)c1ccc(NC(=O)CCS(=O)(=O)c2ccccc2OC)c(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28N2O4S.C2HF3O2/c1-5-23(6-2)17-11-12-18(16(3)15-17)22-21(24)13-14-28(25,26)20-10-8-7-9-19(20)27-4;3-2(4,5)1(6)7/h7-12,15H,5-6,13-14H2,1-4H3,(H,22,24);(H,6,7) |
| InChIKey | VOYJGZYLQRNMJA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|