C18H14Cl3N4O4S2+ — CID 56606234
(5S)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]amino]-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-1-carboxylic acid (PubChem CID 56606234) has the molecular formula C18H14Cl3N4O4S2+ and a molecular weight of 520.83 g/mol. Its IUPAC name is (5S)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]amino]-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-1-carboxylic acid.
| Compound Name | (5S)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]amino]-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 56606234 |
| Molecular Formula | C18H14Cl3N4O4S2+ |
| Molecular Weight | 520.83 g/mol |
| Exact Mass | 518.95 |
| IUPAC Name | (5S)-6-[[2-(2-amino-1,3-thiazol-4-yl)-3-(2,3,6-trichlorophenyl)prop-2-enoyl]amino]-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-1-carboxylic acid |
| SMILES | Nc1nc(C(=Cc2c(Cl)ccc(Cl)c2Cl)C(=O)NC2C(=O)[N+]3(C(=O)O)CCS[C@@H]23)cs1 |
| InChI | InChI=1S/C18H13Cl3N4O4S2/c19-9-1-2-10(20)12(21)7(9)5-8(11-6-31-17(22)23-11)14(26)24-13-15(27)25(18(28)29)3-4-30-16(13)25/h1-2,5-6,13,16H,3-4H2,(H3-,22,23,24,26,28,29)/p+1/t13?,16-,25?/m0/s1 |
| InChIKey | WLXJILKNGNCQDI-ZTKGMFRUSA-O |
| XLogP | 3.82 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|