C25H26N2O3S — CID 56608124
8-(4-tert-butylphenyl)-N-(2-methoxyethyl)-7-oxothieno[2,3-a]quinolizine-10-carboxamide (PubChem CID 56608124) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 8-(4-tert-butylphenyl)-N-(2-methoxyethyl)-7-oxothieno[2,3-a]quinolizine-10-carboxamide.
| Compound Name | 8-(4-tert-butylphenyl)-N-(2-methoxyethyl)-7-oxothieno[2,3-a]quinolizine-10-carboxamide |
|---|---|
| PubChem CID | 56608124 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 8-(4-tert-butylphenyl)-N-(2-methoxyethyl)-7-oxothieno[2,3-a]quinolizine-10-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccc(C(C)(C)C)cc2)c(=O)n2ccc3ccsc3c12 |
| InChI | InChI=1S/C25H26N2O3S/c1-25(2,3)18-7-5-16(6-8-18)19-15-20(23(28)26-11-13-30-4)21-22-17(10-14-31-22)9-12-27(21)24(19)29/h5-10,12,14-15H,11,13H2,1-4H3,(H,26,28) |
| InChIKey | AVIHFXQBHISHGH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|